C16H20FN3O7S — CID 90301201
[3-(2-fluoro-5-nitrophenyl)-2-(2-hydroxyethyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamic acid (PubChem CID 90301201) has the molecular formula C16H20FN3O7S and a molecular weight of 417.42 g/mol. Its IUPAC name is [3-(2-fluoro-5-nitrophenyl)-2-(2-hydroxyethyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamic acid.
| Compound Name | [3-(2-fluoro-5-nitrophenyl)-2-(2-hydroxyethyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 90301201 |
| Molecular Formula | C16H20FN3O7S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [3-(2-fluoro-5-nitrophenyl)-2-(2-hydroxyethyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamic acid |
| SMILES | CC1(c2cc([N+](=O)[O-])ccc2F)N=C(NC(=O)O)C(C)(C)S(=O)(=O)C1CCO |
| InChI | InChI=1S/C16H20FN3O7S/c1-15(2)13(18-14(22)23)19-16(3,12(6-7-21)28(15,26)27)10-8-9(20(24)25)4-5-11(10)17/h4-5,8,12,21H,6-7H2,1-3H3,(H,18,19)(H,22,23) |
| InChIKey | CLWHUFNRYHKWJW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|