C22H28FN3O8S — CID 90301762
[3-(2-fluoro-5-nitrophenyl)-3,6,6-trimethyl-1,1-dioxo-2-prop-2-enyl-2H-1,4-thiazin-5-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid (PubChem CID 90301762) has the molecular formula C22H28FN3O8S and a molecular weight of 513.54 g/mol. Its IUPAC name is [3-(2-fluoro-5-nitrophenyl)-3,6,6-trimethyl-1,1-dioxo-2-prop-2-enyl-2H-1,4-thiazin-5-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid.
| Compound Name | [3-(2-fluoro-5-nitrophenyl)-3,6,6-trimethyl-1,1-dioxo-2-prop-2-enyl-2H-1,4-thiazin-5-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
|---|---|
| PubChem CID | 90301762 |
| Molecular Formula | C22H28FN3O8S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [3-(2-fluoro-5-nitrophenyl)-3,6,6-trimethyl-1,1-dioxo-2-prop-2-enyl-2H-1,4-thiazin-5-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
| SMILES | C=CCC1C(C)(c2cc([N+](=O)[O-])ccc2F)N=C(N(C(=O)O)C(=O)OC(C)(C)C)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C22H28FN3O8S/c1-8-9-16-22(7,14-12-13(26(30)31)10-11-15(14)23)24-17(21(5,6)35(16,32)33)25(18(27)28)19(29)34-20(2,3)4/h8,10-12,16H,1,9H2,2-7H3,(H,27,28) |
| InChIKey | KXADRDOXDRDOAX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|