C15H16FNO6 — CID 150526681
1-(2-fluoro-5-nitrophenyl)-3-methylcyclohexane-1,3-dicarboxylic acid (PubChem CID 150526681) has the molecular formula C15H16FNO6 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-(2-fluoro-5-nitrophenyl)-3-methylcyclohexane-1,3-dicarboxylic acid.
| Compound Name | 1-(2-fluoro-5-nitrophenyl)-3-methylcyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150526681 |
| Molecular Formula | C15H16FNO6 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(2-fluoro-5-nitrophenyl)-3-methylcyclohexane-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CCCC(C(=O)O)(c2cc([N+](=O)[O-])ccc2F)C1 |
| InChI | InChI=1S/C15H16FNO6/c1-14(12(18)19)5-2-6-15(8-14,13(20)21)10-7-9(17(22)23)3-4-11(10)16/h3-4,7H,2,5-6,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ICYQTYRSQASJGY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|