C18H16F2O2 — CID 117486987
1-[2-fluoro-5-(4-fluorophenyl)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 117486987) has the molecular formula C18H16F2O2 and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-[2-fluoro-5-(4-fluorophenyl)phenyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-fluoro-5-(4-fluorophenyl)phenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117486987 |
| Molecular Formula | C18H16F2O2 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[2-fluoro-5-(4-fluorophenyl)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(-c3ccc(F)cc3)ccc2F)CCCC1 |
| InChI | InChI=1S/C18H16F2O2/c19-14-6-3-12(4-7-14)13-5-8-16(20)15(11-13)18(17(21)22)9-1-2-10-18/h3-8,11H,1-2,9-10H2,(H,21,22) |
| InChIKey | IZGALUDKAIHAON-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |