C14H15FO3 — CID 117378661
1-(4-fluoro-2-formylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117378661) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-(4-fluoro-2-formylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-fluoro-2-formylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117378661 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-(4-fluoro-2-formylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=Cc1cc(F)ccc1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H15FO3/c15-11-4-5-12(10(8-11)9-16)14(13(17)18)6-2-1-3-7-14/h4-5,8-9H,1-3,6-7H2,(H,17,18) |
| InChIKey | DZXUJSNXKXEFPE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|