1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid

C14H16F2O2 — CID 117388740

IUPAC1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid
SMILESCc1cc(F)c(F)cc1C1(C(=O)O)CCCCC1
InChIInChI=1S/C14H16F2O2/c1-9-7-11(15)12(16)8-10(9)14(13(17)18)5-3-2-4-6-14/h7-8H,2-6H2,1H3,(H,17,18)
InChIKeyROAYCTONSYEGAA-UHFFFAOYSA-N
MW254.28 g/mol
LogP3.56
Rot. Bonds2

About 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid

1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117388740) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid
PubChem CID117388740
Molecular FormulaC14H16F2O2
Molecular Weight254.28 g/mol
Exact Mass254.11
IUPAC Name1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid
SMILESCc1cc(F)c(F)cc1C1(C(=O)O)CCCCC1
InChIInChI=1S/C14H16F2O2/c1-9-7-11(15)12(16)8-10(9)14(13(17)18)5-3-2-4-6-14/h7-8H,2-6H2,1H3,(H,17,18)
InChIKeyROAYCTONSYEGAA-UHFFFAOYSA-N
XLogP3.56
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.28
LogP ≤ 53.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid (CID 117388740) is 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid is Cc1cc(F)c(F)cc1C1(C(=O)O)CCCCC1.
What is the InChIKey of 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid?
The InChIKey is ROAYCTONSYEGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2O2/c1-9-7-11(15)12(16)8-10(9)14(13(17)18)5-3-2-4-6-14/h7-8H,2-6H2,1H3,(H,17,18).
What are the key properties of 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid?
1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid has a molecular weight of 254.28 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-difluoro-2-methylphenyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 117388740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).