C14H17FO4 — CID 117424291
1-(2-fluoro-3,4-dihydroxy-5-methylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117424291) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-fluoro-3,4-dihydroxy-5-methylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-fluoro-3,4-dihydroxy-5-methylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117424291 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(2-fluoro-3,4-dihydroxy-5-methylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(C2(C(=O)O)CCCCC2)c(F)c(O)c1O |
| InChI | InChI=1S/C14H17FO4/c1-8-7-9(10(15)12(17)11(8)16)14(13(18)19)5-3-2-4-6-14/h7,16-17H,2-6H2,1H3,(H,18,19) |
| InChIKey | SQGBSKUEGOCNTI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|