C15H18F2O3 — CID 117457683
1-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]cyclohexane-1-carboxylic acid (PubChem CID 117457683) has the molecular formula C15H18F2O3 and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117457683 |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-[3-(difluoromethyl)-4-hydroxy-5-methylphenyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(C2(C(=O)O)CCCCC2)cc(C(F)F)c1O |
| InChI | InChI=1S/C15H18F2O3/c1-9-7-10(8-11(12(9)18)13(16)17)15(14(19)20)5-3-2-4-6-15/h7-8,13,18H,2-6H2,1H3,(H,19,20) |
| InChIKey | LERYBDKBJZEPQW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |