C14H15FO5 — CID 117453420
5-(1-carboxycyclohexyl)-3-fluoro-2-hydroxybenzoic acid (PubChem CID 117453420) has the molecular formula C14H15FO5 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-(1-carboxycyclohexyl)-3-fluoro-2-hydroxybenzoic acid.
| Compound Name | 5-(1-carboxycyclohexyl)-3-fluoro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 117453420 |
| Molecular Formula | C14H15FO5 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-(1-carboxycyclohexyl)-3-fluoro-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C2(C(=O)O)CCCCC2)cc(F)c1O |
| InChI | InChI=1S/C14H15FO5/c15-10-7-8(6-9(11(10)16)12(17)18)14(13(19)20)4-2-1-3-5-14/h6-7,16H,1-5H2,(H,17,18)(H,19,20) |
| InChIKey | UGJJFVZXXFQFJW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |