C10H7BrF2O2 — CID 84811106
1-(4-bromo-3,5-difluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 84811106) has the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. Its IUPAC name is 1-(4-bromo-3,5-difluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(4-bromo-3,5-difluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 84811106 |
| Molecular Formula | C10H7BrF2O2 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 1-(4-bromo-3,5-difluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(F)c(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C10H7BrF2O2/c11-8-6(12)3-5(4-7(8)13)10(1-2-10)9(14)15/h3-4H,1-2H2,(H,14,15) |
| InChIKey | NEEZYIDLQTYTEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|