C10H8ClFO3 — CID 117333149
1-(3-chloro-5-fluoro-4-hydroxyphenyl)cyclopropane-1-carboxylic acid (PubChem CID 117333149) has the molecular formula C10H8ClFO3 and a molecular weight of 230.62 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-4-hydroxyphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3-chloro-5-fluoro-4-hydroxyphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117333149 |
| Molecular Formula | C10H8ClFO3 |
| Molecular Weight | 230.62 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 1-(3-chloro-5-fluoro-4-hydroxyphenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(F)c(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C10H8ClFO3/c11-6-3-5(4-7(12)8(6)13)10(1-2-10)9(14)15/h3-4,13H,1-2H2,(H,14,15) |
| InChIKey | GIMHEIVDXLIJIN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.62 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |