C10H6ClF3O2 — CID 117112356
1-(4-chloro-2,3,5-trifluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 117112356) has the molecular formula C10H6ClF3O2 and a molecular weight of 250.60 g/mol. Its IUPAC name is 1-(4-chloro-2,3,5-trifluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(4-chloro-2,3,5-trifluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117112356 |
| Molecular Formula | C10H6ClF3O2 |
| Molecular Weight | 250.60 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-(4-chloro-2,3,5-trifluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C10H6ClF3O2/c11-6-5(12)3-4(7(13)8(6)14)10(1-2-10)9(15)16/h3H,1-2H2,(H,15,16) |
| InChIKey | WUXPUMHLZVGINN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|