C13H12ClF3O2 — CID 117114085
1-(3-chloro-2,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid (PubChem CID 117114085) has the molecular formula C13H12ClF3O2 and a molecular weight of 292.68 g/mol. Its IUPAC name is 1-(3-chloro-2,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(3-chloro-2,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117114085 |
| Molecular Formula | C13H12ClF3O2 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(3-chloro-2,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(F)c(F)c(Cl)c2F)CCCCC1 |
| InChI | InChI=1S/C13H12ClF3O2/c14-9-10(16)7(6-8(15)11(9)17)13(12(18)19)4-2-1-3-5-13/h6H,1-5H2,(H,18,19) |
| InChIKey | KSBGFSSLBAZQSW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|