C10H7F3O3 — CID 84795239
1-(3,4,5-trifluoro-2-hydroxyphenyl)cyclopropane-1-carboxylic acid (PubChem CID 84795239) has the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. Its IUPAC name is 1-(3,4,5-trifluoro-2-hydroxyphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3,4,5-trifluoro-2-hydroxyphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 84795239 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 1-(3,4,5-trifluoro-2-hydroxyphenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(F)c(F)c(F)c2O)CC1 |
| InChI | InChI=1S/C10H7F3O3/c11-5-3-4(8(14)7(13)6(5)12)10(1-2-10)9(15)16/h3,14H,1-2H2,(H,15,16) |
| InChIKey | YTMHJKSKFGQEQP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|