C9H8F3NO — CID 84777063
6-(1-aminocyclopropyl)-2,3,4-trifluorophenol (PubChem CID 84777063) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is 6-(1-aminocyclopropyl)-2,3,4-trifluorophenol.
| Compound Name | 6-(1-aminocyclopropyl)-2,3,4-trifluorophenol |
|---|---|
| PubChem CID | 84777063 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 6-(1-aminocyclopropyl)-2,3,4-trifluorophenol |
| SMILES | NC1(c2cc(F)c(F)c(F)c2O)CC1 |
| InChI | InChI=1S/C9H8F3NO/c10-5-3-4(9(13)1-2-9)8(14)7(12)6(5)11/h3,14H,1-2,13H2 |
| InChIKey | OOPQDPFIAFDSBW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|