C10H10F3NO — CID 84785078
6-[1-(aminomethyl)cyclopropyl]-2,3,4-trifluorophenol (PubChem CID 84785078) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 6-[1-(aminomethyl)cyclopropyl]-2,3,4-trifluorophenol.
| Compound Name | 6-[1-(aminomethyl)cyclopropyl]-2,3,4-trifluorophenol |
|---|---|
| PubChem CID | 84785078 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-[1-(aminomethyl)cyclopropyl]-2,3,4-trifluorophenol |
| SMILES | NCC1(c2cc(F)c(F)c(F)c2O)CC1 |
| InChI | InChI=1S/C10H10F3NO/c11-6-3-5(10(4-14)1-2-10)9(15)8(13)7(6)12/h3,15H,1-2,4,14H2 |
| InChIKey | ZYGKAHHHFDONJP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|