C10H10ClF2N — CID 117310225
[1-(2-chloro-4,5-difluorophenyl)cyclopropyl]methanamine (PubChem CID 117310225) has the molecular formula C10H10ClF2N and a molecular weight of 217.65 g/mol. Its IUPAC name is [1-(2-chloro-4,5-difluorophenyl)cyclopropyl]methanamine.
| Compound Name | [1-(2-chloro-4,5-difluorophenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117310225 |
| Molecular Formula | C10H10ClF2N |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | [1-(2-chloro-4,5-difluorophenyl)cyclopropyl]methanamine |
| SMILES | NCC1(c2cc(F)c(F)cc2Cl)CC1 |
| InChI | InChI=1S/C10H10ClF2N/c11-7-4-9(13)8(12)3-6(7)10(5-14)1-2-10/h3-4H,1-2,5,14H2 |
| InChIKey | FYIWTKJNCOBSNO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|