C10H10F3N — CID 75366182
[1-(2,3,4-trifluorophenyl)cyclopropyl]methanamine (PubChem CID 75366182) has the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. Its IUPAC name is [1-(2,3,4-trifluorophenyl)cyclopropyl]methanamine.
| Compound Name | [1-(2,3,4-trifluorophenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 75366182 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | [1-(2,3,4-trifluorophenyl)cyclopropyl]methanamine |
| SMILES | NCC1(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C10H10F3N/c11-7-2-1-6(8(12)9(7)13)10(5-14)3-4-10/h1-2H,3-5,14H2 |
| InChIKey | LGFRAMQTSDWHFU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|