C12H14BrF2N — CID 117468475
[1-(2-bromo-3,4-difluorophenyl)cyclopentyl]methanamine (PubChem CID 117468475) has the molecular formula C12H14BrF2N and a molecular weight of 290.15 g/mol. Its IUPAC name is [1-(2-bromo-3,4-difluorophenyl)cyclopentyl]methanamine.
| Compound Name | [1-(2-bromo-3,4-difluorophenyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117468475 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [1-(2-bromo-3,4-difluorophenyl)cyclopentyl]methanamine |
| SMILES | NCC1(c2ccc(F)c(F)c2Br)CCCC1 |
| InChI | InChI=1S/C12H14BrF2N/c13-10-8(3-4-9(14)11(10)15)12(7-16)5-1-2-6-12/h3-4H,1-2,5-7,16H2 |
| InChIKey | CENHIRZHSZEJOE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|