C12H13BrF3N — CID 117492969
[1-(3-bromo-2,4,6-trifluorophenyl)cyclopentyl]methanamine (PubChem CID 117492969) has the molecular formula C12H13BrF3N and a molecular weight of 308.14 g/mol. Its IUPAC name is [1-(3-bromo-2,4,6-trifluorophenyl)cyclopentyl]methanamine.
| Compound Name | [1-(3-bromo-2,4,6-trifluorophenyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117492969 |
| Molecular Formula | C12H13BrF3N |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | [1-(3-bromo-2,4,6-trifluorophenyl)cyclopentyl]methanamine |
| SMILES | NCC1(c2c(F)cc(F)c(Br)c2F)CCCC1 |
| InChI | InChI=1S/C12H13BrF3N/c13-10-8(15)5-7(14)9(11(10)16)12(6-17)3-1-2-4-12/h5H,1-4,6,17H2 |
| InChIKey | MYVLBAAVQKZSAD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|