C12H14ClF2N — CID 117366660
[1-(4-chloro-2,6-difluorophenyl)cyclopentyl]methanamine (PubChem CID 117366660) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is [1-(4-chloro-2,6-difluorophenyl)cyclopentyl]methanamine.
| Compound Name | [1-(4-chloro-2,6-difluorophenyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117366660 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [1-(4-chloro-2,6-difluorophenyl)cyclopentyl]methanamine |
| SMILES | NCC1(c2c(F)cc(Cl)cc2F)CCCC1 |
| InChI | InChI=1S/C12H14ClF2N/c13-8-5-9(14)11(10(15)6-8)12(7-16)3-1-2-4-12/h5-6H,1-4,7,16H2 |
| InChIKey | HMXYFMOBPNYCLF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |