C12H15F2NO — CID 84791406
4-[1-(aminomethyl)cyclopentyl]-3,5-difluorophenol (PubChem CID 84791406) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-[1-(aminomethyl)cyclopentyl]-3,5-difluorophenol.
| Compound Name | 4-[1-(aminomethyl)cyclopentyl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 84791406 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[1-(aminomethyl)cyclopentyl]-3,5-difluorophenol |
| SMILES | NCC1(c2c(F)cc(O)cc2F)CCCC1 |
| InChI | InChI=1S/C12H15F2NO/c13-9-5-8(16)6-10(14)11(9)12(7-15)3-1-2-4-12/h5-6,16H,1-4,7,15H2 |
| InChIKey | YSWBKZJGQNMXRN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |