C10H12F2N2 — CID 117047234
2-[1-(aminomethyl)cyclopropyl]-3,4-difluoroaniline (PubChem CID 117047234) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclopropyl]-3,4-difluoroaniline.
| Compound Name | 2-[1-(aminomethyl)cyclopropyl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 117047234 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-[1-(aminomethyl)cyclopropyl]-3,4-difluoroaniline |
| SMILES | NCC1(c2c(N)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C10H12F2N2/c11-6-1-2-7(14)8(9(6)12)10(5-13)3-4-10/h1-2H,3-5,13-14H2 |
| InChIKey | GSGXZQAQRDZQJS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|