C10H11F2NO — CID 84775167
4-[1-(aminomethyl)cyclopropyl]-2,6-difluorophenol (PubChem CID 84775167) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 4-[1-(aminomethyl)cyclopropyl]-2,6-difluorophenol.
| Compound Name | 4-[1-(aminomethyl)cyclopropyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 84775167 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-[1-(aminomethyl)cyclopropyl]-2,6-difluorophenol |
| SMILES | NCC1(c2cc(F)c(O)c(F)c2)CC1 |
| InChI | InChI=1S/C10H11F2NO/c11-7-3-6(4-8(12)9(7)14)10(5-13)1-2-10/h3-4,14H,1-2,5,13H2 |
| InChIKey | LANKQFGJNYGPNC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |