C11H14F2N2 — CID 117113164
5-[1-(aminomethyl)cyclobutyl]-2,3-difluoroaniline (PubChem CID 117113164) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-[1-(aminomethyl)cyclobutyl]-2,3-difluoroaniline.
| Compound Name | 5-[1-(aminomethyl)cyclobutyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 117113164 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-[1-(aminomethyl)cyclobutyl]-2,3-difluoroaniline |
| SMILES | NCC1(c2cc(N)c(F)c(F)c2)CCC1 |
| InChI | InChI=1S/C11H14F2N2/c12-8-4-7(5-9(15)10(8)13)11(6-14)2-1-3-11/h4-5H,1-3,6,14-15H2 |
| InChIKey | NZOSWSYETTWACU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|