C9H9BrFNO2 — CID 84806896
4-(1-aminocyclopropyl)-2-bromo-6-fluorobenzene-1,3-diol (PubChem CID 84806896) has the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-2-bromo-6-fluorobenzene-1,3-diol.
| Compound Name | 4-(1-aminocyclopropyl)-2-bromo-6-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84806896 |
| Molecular Formula | C9H9BrFNO2 |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 4-(1-aminocyclopropyl)-2-bromo-6-fluorobenzene-1,3-diol |
| SMILES | NC1(c2cc(F)c(O)c(Br)c2O)CC1 |
| InChI | InChI=1S/C9H9BrFNO2/c10-6-7(13)4(9(12)1-2-9)3-5(11)8(6)14/h3,13-14H,1-2,12H2 |
| InChIKey | HTKYURCTTKWDSW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|