C9H9F2NO — CID 117280020
4-(1-aminocyclopropyl)-2,5-difluorophenol (PubChem CID 117280020) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-2,5-difluorophenol.
| Compound Name | 4-(1-aminocyclopropyl)-2,5-difluorophenol |
|---|---|
| PubChem CID | 117280020 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-(1-aminocyclopropyl)-2,5-difluorophenol |
| SMILES | NC1(c2cc(F)c(O)cc2F)CC1 |
| InChI | InChI=1S/C9H9F2NO/c10-6-4-8(13)7(11)3-5(6)9(12)1-2-9/h3-4,13H,1-2,12H2 |
| InChIKey | WYJHGPUPQPDPHL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |