C11H12BrF2N — CID 84810883
1-(5-bromo-2,4-difluorophenyl)cyclopentan-1-amine (PubChem CID 84810883) has the molecular formula C11H12BrF2N and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)cyclopentan-1-amine.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 84810883 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)cyclopentan-1-amine |
| SMILES | NC1(c2cc(Br)c(F)cc2F)CCCC1 |
| InChI | InChI=1S/C11H12BrF2N/c12-8-5-7(9(13)6-10(8)14)11(15)3-1-2-4-11/h5-6H,1-4,15H2 |
| InChIKey | ZRSXJMPACIGUHL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|