C11H8BrF2N — CID 84809468
1-(5-bromo-2,4-difluorophenyl)cyclobutane-1-carbonitrile (PubChem CID 84809468) has the molecular formula C11H8BrF2N and a molecular weight of 272.09 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)cyclobutane-1-carbonitrile.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 84809468 |
| Molecular Formula | C11H8BrF2N |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2cc(Br)c(F)cc2F)CCC1 |
| InChI | InChI=1S/C11H8BrF2N/c12-8-4-7(9(13)5-10(8)14)11(6-15)2-1-3-11/h4-5H,1-3H2 |
| InChIKey | VBYKKGVGIUUKGH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|