C9H9BrF2N2 — CID 166607952
3-(4-bromo-2,5-difluorophenyl)azetidin-3-amine (PubChem CID 166607952) has the molecular formula C9H9BrF2N2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluorophenyl)azetidin-3-amine.
| Compound Name | 3-(4-bromo-2,5-difluorophenyl)azetidin-3-amine |
|---|---|
| PubChem CID | 166607952 |
| Molecular Formula | C9H9BrF2N2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 3-(4-bromo-2,5-difluorophenyl)azetidin-3-amine |
| SMILES | NC1(c2cc(F)c(Br)cc2F)CNC1 |
| InChI | InChI=1S/C9H9BrF2N2/c10-6-2-7(11)5(1-8(6)12)9(13)3-14-4-9/h1-2,14H,3-4,13H2 |
| InChIKey | HRXRKOFSMDFRHY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|