About 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride
5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride (PubChem CID 136576261) has the molecular formula C10H12BrClFN
and a molecular weight of 280.57 g/mol. Its IUPAC name is 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride |
| PubChem CID | 136576261 |
| Molecular Formula | C10H12BrClFN |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride |
| SMILES | CC1(C)CNc2cc(F)c(Br)cc21.Cl |
| InChI | InChI=1S/C10H11BrFN.ClH/c1-10(2)5-13-9-4-8(12)7(11)3-6(9)10;/h3-4,13H,5H2,1-2H3;1H |
| InChIKey | NNECQJFJDHPJLM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride?
The IUPAC name of 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride (CID 136576261) is 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride.
What is the SMILES notation for 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride?
The canonical SMILES for 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride is CC1(C)CNc2cc(F)c(Br)cc21.Cl.
What is the InChIKey of 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride?
The InChIKey is NNECQJFJDHPJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrFN.ClH/c1-10(2)5-13-9-4-8(12)7(11)3-6(9)10;/h3-4,13H,5H2,1-2H3;1H.
What are the key properties of 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride?
5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride has a molecular weight of 280.57 g/mol, XLogP of 3.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-fluoro-3,3-dimethyl-1,2-dihydroindole;hydrochloride is sourced from PubChem (CID 136576261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).