C10H11BrFN — CID 178022194
6-bromo-4-fluoro-3,3-dimethyl-1,2-dihydroindole (PubChem CID 178022194) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 6-bromo-4-fluoro-3,3-dimethyl-1,2-dihydroindole.
| Compound Name | 6-bromo-4-fluoro-3,3-dimethyl-1,2-dihydroindole |
|---|---|
| PubChem CID | 178022194 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 6-bromo-4-fluoro-3,3-dimethyl-1,2-dihydroindole |
| SMILES | CC1(C)CNc2cc(Br)cc(F)c21 |
| InChI | InChI=1S/C10H11BrFN/c1-10(2)5-13-8-4-6(11)3-7(12)9(8)10/h3-4,13H,5H2,1-2H3 |
| InChIKey | KBOPZPUGTDJYPE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |