C10H7F2NO2 — CID 117300925
2,5-difluoro-4-(1-isocyanatocyclopropyl)phenol (PubChem CID 117300925) has the molecular formula C10H7F2NO2 and a molecular weight of 211.17 g/mol. Its IUPAC name is 2,5-difluoro-4-(1-isocyanatocyclopropyl)phenol.
| Compound Name | 2,5-difluoro-4-(1-isocyanatocyclopropyl)phenol |
|---|---|
| PubChem CID | 117300925 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2,5-difluoro-4-(1-isocyanatocyclopropyl)phenol |
| SMILES | O=C=NC1(c2cc(F)c(O)cc2F)CC1 |
| InChI | InChI=1S/C10H7F2NO2/c11-7-4-9(15)8(12)3-6(7)10(1-2-10)13-5-14/h3-4,15H,1-2H2 |
| InChIKey | YERIGYWDVRQCHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|