C12H11F2NO2 — CID 117350081
2,3-difluoro-6-(1-isocyanatocyclopentyl)phenol (PubChem CID 117350081) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2,3-difluoro-6-(1-isocyanatocyclopentyl)phenol.
| Compound Name | 2,3-difluoro-6-(1-isocyanatocyclopentyl)phenol |
|---|---|
| PubChem CID | 117350081 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2,3-difluoro-6-(1-isocyanatocyclopentyl)phenol |
| SMILES | O=C=NC1(c2ccc(F)c(F)c2O)CCCC1 |
| InChI | InChI=1S/C12H11F2NO2/c13-9-4-3-8(11(17)10(9)14)12(15-7-16)5-1-2-6-12/h3-4,17H,1-2,5-6H2 |
| InChIKey | PHDLVWYUASBPIQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|