C11H8BrF2NO — CID 117464584
1-bromo-2,3-difluoro-4-(1-isocyanatocyclobutyl)benzene (PubChem CID 117464584) has the molecular formula C11H8BrF2NO and a molecular weight of 288.09 g/mol. Its IUPAC name is 1-bromo-2,3-difluoro-4-(1-isocyanatocyclobutyl)benzene.
| Compound Name | 1-bromo-2,3-difluoro-4-(1-isocyanatocyclobutyl)benzene |
|---|---|
| PubChem CID | 117464584 |
| Molecular Formula | C11H8BrF2NO |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 1-bromo-2,3-difluoro-4-(1-isocyanatocyclobutyl)benzene |
| SMILES | O=C=NC1(c2ccc(Br)c(F)c2F)CCC1 |
| InChI | InChI=1S/C11H8BrF2NO/c12-8-3-2-7(9(13)10(8)14)11(15-6-16)4-1-5-11/h2-3H,1,4-5H2 |
| InChIKey | BADGVDFORKMUFK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|