C12H10BrF2NO — CID 117486046
1-bromo-4,5-difluoro-2-(1-isocyanatocyclopentyl)benzene (PubChem CID 117486046) has the molecular formula C12H10BrF2NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 1-bromo-4,5-difluoro-2-(1-isocyanatocyclopentyl)benzene.
| Compound Name | 1-bromo-4,5-difluoro-2-(1-isocyanatocyclopentyl)benzene |
|---|---|
| PubChem CID | 117486046 |
| Molecular Formula | C12H10BrF2NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-bromo-4,5-difluoro-2-(1-isocyanatocyclopentyl)benzene |
| SMILES | O=C=NC1(c2cc(F)c(F)cc2Br)CCCC1 |
| InChI | InChI=1S/C12H10BrF2NO/c13-9-6-11(15)10(14)5-8(9)12(16-7-17)3-1-2-4-12/h5-6H,1-4H2 |
| InChIKey | UPIHSBHQDJVUSA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|