C13H11F2NO3 — CID 117421153
2,5-difluoro-4-(1-isocyanatocyclopentyl)benzoic acid (PubChem CID 117421153) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 2,5-difluoro-4-(1-isocyanatocyclopentyl)benzoic acid.
| Compound Name | 2,5-difluoro-4-(1-isocyanatocyclopentyl)benzoic acid |
|---|---|
| PubChem CID | 117421153 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2,5-difluoro-4-(1-isocyanatocyclopentyl)benzoic acid |
| SMILES | O=C=NC1(c2cc(F)c(C(=O)O)cc2F)CCCC1 |
| InChI | InChI=1S/C13H11F2NO3/c14-10-6-9(11(15)5-8(10)12(18)19)13(16-7-17)3-1-2-4-13/h5-6H,1-4H2,(H,18,19) |
| InChIKey | WLKIDHMYGGIBKV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|