C11H8ClF2NO — CID 117361034
1-chloro-2,4-difluoro-5-(1-isocyanatocyclobutyl)benzene (PubChem CID 117361034) has the molecular formula C11H8ClF2NO and a molecular weight of 243.64 g/mol. Its IUPAC name is 1-chloro-2,4-difluoro-5-(1-isocyanatocyclobutyl)benzene.
| Compound Name | 1-chloro-2,4-difluoro-5-(1-isocyanatocyclobutyl)benzene |
|---|---|
| PubChem CID | 117361034 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-chloro-2,4-difluoro-5-(1-isocyanatocyclobutyl)benzene |
| SMILES | O=C=NC1(c2cc(Cl)c(F)cc2F)CCC1 |
| InChI | InChI=1S/C11H8ClF2NO/c12-8-4-7(9(13)5-10(8)14)11(15-6-16)2-1-3-11/h4-5H,1-3H2 |
| InChIKey | GEUKUIGDRPNQHM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|