C11H9F2NO — CID 117298200
1,5-difluoro-2-(1-isocyanatocyclopropyl)-4-methylbenzene (PubChem CID 117298200) has the molecular formula C11H9F2NO and a molecular weight of 209.19 g/mol. Its IUPAC name is 1,5-difluoro-2-(1-isocyanatocyclopropyl)-4-methylbenzene.
| Compound Name | 1,5-difluoro-2-(1-isocyanatocyclopropyl)-4-methylbenzene |
|---|---|
| PubChem CID | 117298200 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1,5-difluoro-2-(1-isocyanatocyclopropyl)-4-methylbenzene |
| SMILES | Cc1cc(C2(N=C=O)CC2)c(F)cc1F |
| InChI | InChI=1S/C11H9F2NO/c1-7-4-8(10(13)5-9(7)12)11(2-3-11)14-6-15/h4-5H,2-3H2,1H3 |
| InChIKey | LORFWHBQYBLNCD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|