C10H9FO4 — CID 117302547
1-(4-fluoro-2,5-dihydroxyphenyl)cyclopropane-1-carboxylic acid (PubChem CID 117302547) has the molecular formula C10H9FO4 and a molecular weight of 212.18 g/mol. Its IUPAC name is 1-(4-fluoro-2,5-dihydroxyphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(4-fluoro-2,5-dihydroxyphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117302547 |
| Molecular Formula | C10H9FO4 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1-(4-fluoro-2,5-dihydroxyphenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(O)c(F)cc2O)CC1 |
| InChI | InChI=1S/C10H9FO4/c11-6-4-7(12)5(3-8(6)13)10(1-2-10)9(14)15/h3-4,12-13H,1-2H2,(H,14,15) |
| InChIKey | CBSGWLKHXZQORY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|