C11H10F2O3 — CID 117328253
1-[5-(difluoromethyl)-2-hydroxyphenyl]cyclopropane-1-carboxylic acid (PubChem CID 117328253) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-2-hydroxyphenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-(difluoromethyl)-2-hydroxyphenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117328253 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-[5-(difluoromethyl)-2-hydroxyphenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(C(F)F)ccc2O)CC1 |
| InChI | InChI=1S/C11H10F2O3/c12-9(13)6-1-2-8(14)7(5-6)11(3-4-11)10(15)16/h1-2,5,9,14H,3-4H2,(H,15,16) |
| InChIKey | ZTMMPRTWCXDJJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |