C11H10ClFO2 — CID 83412485
1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid (PubChem CID 83412485) has the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 83412485 |
| Molecular Formula | C11H10ClFO2 |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(Cl)cc2F)CCC1 |
| InChI | InChI=1S/C11H10ClFO2/c12-7-2-3-8(9(13)6-7)11(10(14)15)4-1-5-11/h2-3,6H,1,4-5H2,(H,14,15) |
| InChIKey | NTMSIWRMNUANHT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |