C14H17FO4S — CID 117484100
1-(2-fluoro-4-methylsulfonylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117484100) has the molecular formula C14H17FO4S and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylsulfonylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-fluoro-4-methylsulfonylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117484100 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(2-fluoro-4-methylsulfonylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C2(C(=O)O)CCCCC2)c(F)c1 |
| InChI | InChI=1S/C14H17FO4S/c1-20(18,19)10-5-6-11(12(15)9-10)14(13(16)17)7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | WUPYSHISDUTEQH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |