C15H19FO3 — CID 117419802
1-[2-fluoro-5-(methoxymethyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 117419802) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 1-[2-fluoro-5-(methoxymethyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-fluoro-5-(methoxymethyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117419802 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[2-fluoro-5-(methoxymethyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | COCc1ccc(F)c(C2(C(=O)O)CCCCC2)c1 |
| InChI | InChI=1S/C15H19FO3/c1-19-10-11-5-6-13(16)12(9-11)15(14(17)18)7-3-2-4-8-15/h5-6,9H,2-4,7-8,10H2,1H3,(H,17,18) |
| InChIKey | AFUSCEHYMLHBNQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |