C13H14ClFO3 — CID 117434426
1-[5-chloro-2-fluoro-3-(methoxymethyl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 117434426) has the molecular formula C13H14ClFO3 and a molecular weight of 272.70 g/mol. Its IUPAC name is 1-[5-chloro-2-fluoro-3-(methoxymethyl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[5-chloro-2-fluoro-3-(methoxymethyl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117434426 |
| Molecular Formula | C13H14ClFO3 |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-[5-chloro-2-fluoro-3-(methoxymethyl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | COCc1cc(Cl)cc(C2(C(=O)O)CCC2)c1F |
| InChI | InChI=1S/C13H14ClFO3/c1-18-7-8-5-9(14)6-10(11(8)15)13(12(16)17)3-2-4-13/h5-6H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | SIPWRXPBNLRRKQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |