1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid

C13H15FO4 — CID 117388602

IUPAC1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid
SMILESCOc1c(F)ccc(C2(C(=O)O)CCC2)c1OC
InChIInChI=1S/C13H15FO4/c1-17-10-8(4-5-9(14)11(10)18-2)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16)
InChIKeyUYTPWSAZSZTRFJ-UHFFFAOYSA-N
MW254.26 g/mol
LogP2.35
Rot. Bonds4

About 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid

1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117388602) has the molecular formula C13H15FO4 and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid
PubChem CID117388602
Molecular FormulaC13H15FO4
Molecular Weight254.26 g/mol
Exact Mass254.10
IUPAC Name1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid
SMILESCOc1c(F)ccc(C2(C(=O)O)CCC2)c1OC
InChIInChI=1S/C13H15FO4/c1-17-10-8(4-5-9(14)11(10)18-2)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16)
InChIKeyUYTPWSAZSZTRFJ-UHFFFAOYSA-N
XLogP2.35
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.26
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid (CID 117388602) is 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid is COc1c(F)ccc(C2(C(=O)O)CCC2)c1OC.
What is the InChIKey of 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid?
The InChIKey is UYTPWSAZSZTRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO4/c1-17-10-8(4-5-9(14)11(10)18-2)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16).
What are the key properties of 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid?
1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid has a molecular weight of 254.26 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-2,3-dimethoxyphenyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 117388602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).