C12H13ClO4 — CID 117394988
1-(4-chloro-2-hydroxy-3-methoxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117394988) has the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-methoxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(4-chloro-2-hydroxy-3-methoxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117394988 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-methoxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | COc1c(Cl)ccc(C2(C(=O)O)CCC2)c1O |
| InChI | InChI=1S/C12H13ClO4/c1-17-10-8(13)4-3-7(9(10)14)12(11(15)16)5-2-6-12/h3-4,14H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | NABXXJLHJAMNMV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |