C13H16O4 — CID 117344782
1-(2-hydroxy-3-methoxyphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117344782) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methoxyphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2-hydroxy-3-methoxyphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117344782 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(2-hydroxy-3-methoxyphenyl)cyclopentane-1-carboxylic acid |
| SMILES | COc1cccc(C2(C(=O)O)CCCC2)c1O |
| InChI | InChI=1S/C13H16O4/c1-17-10-6-4-5-9(11(10)14)13(12(15)16)7-2-3-8-13/h4-6,14H,2-3,7-8H2,1H3,(H,15,16) |
| InChIKey | SXXNAYBBHAAWCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |