C19H20O4 — CID 117497648
1-(2-hydroxy-3-phenylmethoxyphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117497648) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(2-hydroxy-3-phenylmethoxyphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2-hydroxy-3-phenylmethoxyphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117497648 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(2-hydroxy-3-phenylmethoxyphenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(OCc3ccccc3)c2O)CCCC1 |
| InChI | InChI=1S/C19H20O4/c20-17-15(19(18(21)22)11-4-5-12-19)9-6-10-16(17)23-13-14-7-2-1-3-8-14/h1-3,6-10,20H,4-5,11-13H2,(H,21,22) |
| InChIKey | GKTCBBBEIOPYQB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |