C20H25NO2 — CID 117496323
2-[1-(aminomethyl)cyclohexyl]-6-phenylmethoxyphenol (PubChem CID 117496323) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-6-phenylmethoxyphenol.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-6-phenylmethoxyphenol |
|---|---|
| PubChem CID | 117496323 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-6-phenylmethoxyphenol |
| SMILES | NCC1(c2cccc(OCc3ccccc3)c2O)CCCCC1 |
| InChI | InChI=1S/C20H25NO2/c21-15-20(12-5-2-6-13-20)17-10-7-11-18(19(17)22)23-14-16-8-3-1-4-9-16/h1,3-4,7-11,22H,2,5-6,12-15,21H2 |
| InChIKey | YMHNGGIJLNGYML-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |